| 9 |
외부전장이 P(VDF-co-HFP)/PBA 및 P(VDF-co-HFP)/P(BA-co-BS) 블렌드의 LCST 상분리에 미치는 영향
김영호, 홍성돈, 김갑진
한국고분자학회 2003년 가을 학술대회 |
| 8 |
Fluoroalkyl methacrylate/acrylic acid 공중합체 내의 clay함량에 따른 IPMC(Ionic polymer metal composite)의 물성 변화 연구
김병춘, 권건호, 정한모
한국고분자학회 2003년 가을 학술대회 |
| 7 |
Fluoroalkyl methacrylate/acrylic acid/poly(ethylene glycol) methacrylate macromer로 구성된 ionomeric polymer-metal composite의 물성과 전기 구동 특성
김병춘;정한모
한국고분자학회 2003년 봄 학술대회 |
| 6 |
A Study on the Electroactive Effect of Polyurethanes Ionomer
방주현;김병규;정한모
한국고분자학회 2003년 봄 학술대회 |
| 5 |
Synthesis of electroactive polythiophene derivatives with different protected carboxyl groups via electropolymerization
강승구, 정동준*
한국고분자학회 2002년 가을 학술대회 |
| 4 |
Characterization of Electrically Actuated Alginate/Poly(vinyl alcohol) Blend Film
김인중, 문봉열, 강휘원, 나재운, 정창남
한국고분자학회 2002년 가을 학술대회 |
| 3 |
The Electroactive Alginate/Poly(vinyl alcohol) Film to Improve the Stability under Electric Field
김인중, 문봉열, 나재운, 정창남
한국고분자학회 2002년 봄 학술대회 |
| 2 |
The electroactive hydrogel with silver nanoparticles
강휘원, 문봉열, 정창남
한국고분자학회 2002년 봄 학술대회 |
| 1 |
IPMC(ion-exchange polymer metal composite) 구동기의 특성연구|character of Ion-exchange Polymer Metal compostes Actuators
이준호, 황성덕, 최혁렬, 김훈모, 전재욱, 김성우, 남재도|JunHo Lee, SungDuk Hwang, HyukRyun Choi, HoonMo Kim, JaeWook Jeon, SungWoo Kim,
한국화학공학회 2000년 가을 학술대회 |
