검색결과 : 2건
| No. | Article |
|---|---|
| 1 |
Synthesis and spectroscopic and theoretical characterization of the elongated dihydrogen complex OsCl2(eta(2)-H-2)(NH=CPh2)((PPr3)-Pr-i)(2) Barea G, Esteruelas MA, Lledos A, Lopez AM, Tolosa JI Inorganic Chemistry, 37(19), 5033, 1998 |
| 2 |
Quantum-Mechanical Exchange Coupling in Trihydridoosmium Complexes Containing Azole Ligands Esteruelas MA, Lahoz FJ, Lopez AM, Onate E, Oro LA, Ruiz N, Sola E, Tolosa JI Inorganic Chemistry, 35(26), 7811, 1996 |