Inorganic Chemistry, Vol.40, No.6, 1380-1385, 2001
Anion-directed crystallization of coordination polymers: Syntheses and characterization of Cu-4(2-pzc)(4)(H2O)(8)(Mo8O26)center dot 2H(2)O and Cu-3(2-pzc)(4)(H2O)(2)(V10O28H4)center dot 6.5H(2)O (2-pzc=2-pyrazinecarboxylate)
Two new copper 2-pyrazinecarboxylate (2-pzc) coordination polymers incorporating [Mo8O26](4-) and [V10O28H4](2-) anions were synthesized and structurally characterized: Cu-4(2-pzc)(4))(H2O)(8)(Mo8O26). 2H(2)O (1) and Cu-3(2-pzc)(4)-(H2O)(2)(V10O28H4).6.5H(2)O (2). Crystal data: 1, monoclinic, space group P2(1)/n, a = 11.1547(5) Angstrom, b = 13.4149(6) Angstrom, c = 15.9633(7) Angstrom, beta = 90.816(1)degrees; 2, triclinic, space group P (1) over bar, a = 10.5896(10) Angstrom, b = 10.7921(10) Angstrom, c = 13.5168(13) Angstrom, alpha = 104.689(2)degrees, beta = 99.103(2)degrees, gamma = 113.419(2)degrees. Compound 1 contains {Cu(2-pzc)(H2O)(2)} chains charge-balanced by [Mo8O26](4-) anions. In compound 2, layers of {Cu-3(2-pzc)(4)(H2O)(2)} form cavities that are filled with [V10O28H4](2-) anions. The magnetic properties of both compounds are described.