화학공학소재연구정보센터
Journal of Physical Chemistry A, Vol.110, No.1, 219-227, 2006
Theoretical studies on blue versus red shifts in diglyme-M+-X- (M = Li, Na, and K and X = CF3SO3, PF6, and (CF3SO2)(2)N))
Ab initio Hartree-Fock calculations have been used to obtain the electronic structure and the frequencies of normal vibrations in the 1:1:1 solid polymer electrolytes CH3(OCH2CH2)(2)OCH3-M+-X- (M = Li, Na, and K and X = CF3SO3, PF6, (CF3SO2)(2)N). These calculations predict stronger binding for the lithium ion toward the ether oxygens of diglyme in these electrolytes. Consequences of diglyme-MX interactions to the infrared spectra have been presented. Natural bond analysis and the electron density topography have been used to explain the direction of the frequency shifts of the normal vibrations of the anions in these electrolytes.