Chemistry Letters, Vol.31, No.3, 358-359, 2002
Synthesis and ethylene polymerization behavior of a new titanium complex having two imine-phenoxy chelate ligands
A novel (N-benzylidene-2-hydroxy-3,5-di-t-butyl-aniline)(2)TiCl2 complex was synthesized and investigated for its potential as an ethylene polymerization catalyst in the presence of MAO or Ph3C+B-(C6F5)(4)/(Bu3Al)-Bu-i as a cocatalyst. Upon activation with Ph3C+B-(C6F5)(4)/(Bu3Al)-Bu-i, the complex displayed higher activities at higher temperatures, and the activity reached a very high value of 5784 kg-PE/mol-Ti(.)h at 75degreesC under atmospheric pressure.