Three new heterometallic copper(II)-alkaline-earth metal complexes have been synthesized by using 1,3-bis-(dimethylamino)-2-propanolato (bdmap) and trifluoroacetato as ligands. These three compounds have been formulated as CaCu(bdmap)(2)(O2CCF3)(2)(H2O) (1), Sr2Cu2(bdmap)(4)(O2CCF3)(4) (2), and Sr2Cu4(bdmap)(6)(O2CCF3)(4)(mu(3)-OH)(2) (3), respectively. Their structures have been determined by single-crystal X-ray diffraction analyses. Compound 1 is a dinuclear complex and dimerizes in the solid state through intermolecular hydrogen bonds. Compound 2 is a tetranuclear complex, while compound 3 is a hexanuclear complex, where metal ions are linked together through the bridging ligands. The thermal properties of these compounds have been investigated by thermogravimetric analysis. These compounds decompose to either the corresponding oxide or a mixture of metal fluoride and oxides at temperatures below 400 degrees C. Crystal data : 1, C18H36CuCaF6O7N4, monoclinic, P2(1)/n, a = 13.234(4) Angstrom, b = 15.401(3) Angstrom, c = 14.445(2) Angstrom, beta = 94.79(2)degrees, V = 2934(1) Angstrom(3), Z = 4, d(calc) = 1.445 g cm(-3); 2, C36H68Sr2Cu2F12O12N8, monoclinic, P2(1)/c, a = 13.291(3) Angstrom, b = 11.238(5) Angstrom, c = 18.472(7) Angstrom, beta = 91.51(2), V = 2758(1) Angstrom(3), Z = 2, d(calc) = 1.608 g cm(-3); 3, C50H104Sr2Cu4F(12)O(16)N(12).2C(4)H(8)O, monoclinic, P2(1)/n, a = 16.112(9) Angstrom, b = 19.634(8) Angstrom, c = 16.85(1) Angstrom, beta = 111.63(5)degrees, V = 4954(5) Angstrom(3), Z = 2, d(calc) = 1.29 g cm(-3).