| 번호 | 제목 |
|---|---|
| 1 |
Synthesis and Characterization of 0.65 Pb(Mg1/3Nb2/3)O3-0.35PbTiO3 Nanowires and their Piezoelectric Performance Brindha Moorthy, Changyeon Baek, Seung Jun Lee, Kwi ll park, Do Kyung Kim 한국재료학회 2015년 봄 학술대회 |
| 번호 | 제목 |
|---|---|
| 1 |
Synthesis and Characterization of 0.65 Pb(Mg1/3Nb2/3)O3-0.35PbTiO3 Nanowires and their Piezoelectric Performance Brindha Moorthy, Changyeon Baek, Seung Jun Lee, Kwi ll park, Do Kyung Kim 한국재료학회 2015년 봄 학술대회 |