| 번호 | 제목 |
|---|---|
| 3 |
Synthesis and Characterization of 0.65 Pb(Mg1/3Nb2/3)O3-0.35PbTiO3 Nanowires and their Piezoelectric Performance Brindha Moorthy, Changyeon Baek, Seung Jun Lee, Kwi ll park, Do Kyung Kim 한국재료학회 2015년 봄 학술대회 |
| 2 |
Diblock Copolymers and Their Micelles to Fabricate Catalytic Pt Nanostructures for Graphene Etching 김성수, 손병혁 한국고분자학회 2014년 가을 학술대회 |
| 1 |
Growth Mechanism of Pt Nanostructures and Their Electrochemical Properties 곽다희, 이영우, 박경원 한국공업화학회 2013년 봄 학술대회 |
